C13H18N3+ — CID 166010787
7-methyl-1-(2-methylphenyl)-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-ium (PubChem CID 166010787) has the molecular formula C13H18N3+ and a molecular weight of 216.31 g/mol. Its IUPAC name is 7-methyl-1-(2-methylphenyl)-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-ium.
| Compound Name | 7-methyl-1-(2-methylphenyl)-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-ium |
|---|---|
| PubChem CID | 166010787 |
| Molecular Formula | C13H18N3+ |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 7-methyl-1-(2-methylphenyl)-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-ium |
| SMILES | Cc1ccccc1N1CCN2CC[N+](C)=C21 |
| InChI | InChI=1S/C13H18N3/c1-11-5-3-4-6-12(11)16-10-9-15-8-7-14(2)13(15)16/h3-6H,7-10H2,1-2H3/q+1 |
| InChIKey | MUKWMBMVGFCZFM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|