About 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine
3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine (PubChem CID 166011179) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine.
Molecular Properties
| Compound Name | 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine |
| PubChem CID | 166011179 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine |
| SMILES | CC1=CNC2C(=N1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C17H14N2/c1-11-10-18-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)17(16)19-11/h2-10,16,18H,1H3 |
| InChIKey | XNLKNLIRNVJETL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine?
The IUPAC name of 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine (CID 166011179) is 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine.
What is the SMILES notation for 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine?
The canonical SMILES for 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine is CC1=CNC2C(=N1)c1ccccc1-c1ccccc12.
What is the InChIKey of 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine?
The InChIKey is XNLKNLIRNVJETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-11-10-18-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)17(16)19-11/h2-10,16,18H,1H3.
What are the key properties of 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine?
3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine has a molecular weight of 246.31 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,12b-dihydrophenanthro[9,10-b]pyrazine is sourced from PubChem (CID 166011179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).