C23H32O3 — CID 166011841
2-tert-butyl-6-(3-tert-butyl-5-methoxy-2-methylphenyl)-4-methoxyphenol (PubChem CID 166011841) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-tert-butyl-6-(3-tert-butyl-5-methoxy-2-methylphenyl)-4-methoxyphenol.
| Compound Name | 2-tert-butyl-6-(3-tert-butyl-5-methoxy-2-methylphenyl)-4-methoxyphenol |
|---|---|
| PubChem CID | 166011841 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-tert-butyl-6-(3-tert-butyl-5-methoxy-2-methylphenyl)-4-methoxyphenol |
| SMILES | COc1cc(-c2cc(OC)cc(C(C)(C)C)c2O)c(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H32O3/c1-14-17(10-15(25-8)12-19(14)22(2,3)4)18-11-16(26-9)13-20(21(18)24)23(5,6)7/h10-13,24H,1-9H3 |
| InChIKey | IXOKIVWTGTUONC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |