About 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide
2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide (PubChem CID 166012315) has the molecular formula C25H58N2O3Si4
and a molecular weight of 547.09 g/mol. Its IUPAC name is 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide.
Molecular Properties
| Compound Name | 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide |
| PubChem CID | 166012315 |
| Molecular Formula | C25H58N2O3Si4 |
| Molecular Weight | 547.09 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide |
| SMILES | C=C(N)C(=O)N(CCC[Si](C)(C)O[Si](C)(C)CCCC)CCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C25H58N2O3Si4/c1-12-14-20-31(4,5)29-33(8,9)22-16-18-27(25(28)24(3)26)19-17-23-34(10,11)30-32(6,7)21-15-13-2/h3,12-23,26H2,1-2,4-11H3 |
| InChIKey | DYHSQDCLLPOLJT-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.09 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide?
The IUPAC name of 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide (CID 166012315) is 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide.
What is the SMILES notation for 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide?
The canonical SMILES for 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide is C=C(N)C(=O)N(CCC[Si](C)(C)O[Si](C)(C)CCCC)CCC[Si](C)(C)O[Si](C)(C)CCCC.
What is the InChIKey of 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide?
The InChIKey is DYHSQDCLLPOLJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H58N2O3Si4/c1-12-14-20-31(4,5)29-33(8,9)22-16-18-27(25(28)24(3)26)19-17-23-34(10,11)30-32(6,7)21-15-13-2/h3,12-23,26H2,1-2,4-11H3.
What are the key properties of 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide?
2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide has a molecular weight of 547.09 g/mol, XLogP of 7.52, 19 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]prop-2-enamide is sourced from PubChem (CID 166012315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).