About (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate
(2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 16601271) has the molecular formula C19H12Cl2N2O3
and a molecular weight of 387.22 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate.
Molecular Properties
| Compound Name | (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate |
| PubChem CID | 16601271 |
| Molecular Formula | C19H12Cl2N2O3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | N#Cc1ccc(OC(=O)CCc2ncc(-c3ccc(Cl)cc3)o2)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2O3/c20-14-4-2-13(3-5-14)17-11-23-18(25-17)7-8-19(24)26-16-6-1-12(10-22)9-15(16)21/h1-6,9,11H,7-8H2 |
| InChIKey | SSAGPBHDDDLPIR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate?
The IUPAC name of (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate (CID 16601271) is (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate.
What is the SMILES notation for (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate?
The canonical SMILES for (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate is N#Cc1ccc(OC(=O)CCc2ncc(-c3ccc(Cl)cc3)o2)c(Cl)c1.
What is the InChIKey of (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate?
The InChIKey is SSAGPBHDDDLPIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2N2O3/c20-14-4-2-13(3-5-14)17-11-23-18(25-17)7-8-19(24)26-16-6-1-12(10-22)9-15(16)21/h1-6,9,11H,7-8H2.
What are the key properties of (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate?
(2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate has a molecular weight of 387.22 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-cyanophenyl) 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate is sourced from PubChem (CID 16601271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).