C30H39N5O5 — CID 166012898
(4S,5R)-4-amino-5-[[4-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]butyl]phenyl]methoxy]hexanamide (PubChem CID 166012898) has the molecular formula C30H39N5O5 and a molecular weight of 549.67 g/mol. Its IUPAC name is (4S,5R)-4-amino-5-[[4-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]butyl]phenyl]methoxy]hexanamide.
| Compound Name | (4S,5R)-4-amino-5-[[4-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]butyl]phenyl]methoxy]hexanamide |
|---|---|
| PubChem CID | 166012898 |
| Molecular Formula | C30H39N5O5 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | (4S,5R)-4-amino-5-[[4-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]butyl]phenyl]methoxy]hexanamide |
| SMILES | C[C@@H](OCc1ccc(CCCCc2ccc3c(c2)n(C)c(=O)n3C2CCC(=O)NC2=O)cc1)[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C30H39N5O5/c1-19(23(31)12-15-27(32)36)40-18-22-9-7-20(8-10-22)5-3-4-6-21-11-13-24-26(17-21)34(2)30(39)35(24)25-14-16-28(37)33-29(25)38/h7-11,13,17,19,23,25H,3-6,12,14-16,18,31H2,1-2H3,(H2,32,36)(H,33,37,38)/t19-,23+,25?/m1/s1 |
| InChIKey | TUZYLQMWJWDNRQ-RPGGLDLESA-N |
| XLogP | 2.38 |
| TPSA | 151.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|