C30H21BF4N2 — CID 166015360
17-tert-butyl-20,20,21,21-tetrafluoro-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(27),3,5,7,9,11,13(29),15,17,19(28),23,25-dodecaene (PubChem CID 166015360) has the molecular formula C30H21BF4N2 and a molecular weight of 496.32 g/mol. Its IUPAC name is 17-tert-butyl-20,20,21,21-tetrafluoro-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(27),3,5,7,9,11,13(29),15,17,19(28),23,25-dodecaene.
| Compound Name | 17-tert-butyl-20,20,21,21-tetrafluoro-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(27),3,5,7,9,11,13(29),15,17,19(28),23,25-dodecaene |
|---|---|
| PubChem CID | 166015360 |
| Molecular Formula | C30H21BF4N2 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 17-tert-butyl-20,20,21,21-tetrafluoro-2,22-diaza-14-boraoctacyclo[12.12.1.12,9.115,19.03,8.023,27.013,29.022,28]nonacosa-1(27),3,5,7,9,11,13(29),15,17,19(28),23,25-dodecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)C(F)(F)C(F)(F)N3c1cccc3c1B2c1cccc2c4ccccc4n-3c12 |
| InChI | InChI=1S/C30H21BF4N2/c1-28(2,3)16-14-19-27-21(15-16)31-20-10-6-9-18-17-8-4-5-11-22(17)36(26(18)20)23-12-7-13-24(25(23)31)37(27)30(34,35)29(19,32)33/h4-15H,1-3H3 |
| InChIKey | RBFXKPFODCKRFL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|