About 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium
4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium (PubChem CID 166016888) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium.
Molecular Properties
| Compound Name | 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium |
| PubChem CID | 166016888 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium |
| SMILES | [CH2-][NH+]1CCc2c(C3CNC3)cccc21 |
| InChI | InChI=1S/C12H16N2/c1-14-6-5-11-10(9-7-13-8-9)3-2-4-12(11)14/h2-4,9,13-14H,1,5-8H2 |
| InChIKey | JIMMCMMDBIAHSK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium?
The IUPAC name of 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium (CID 166016888) is 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium.
What is the SMILES notation for 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium?
The canonical SMILES for 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium is [CH2-][NH+]1CCc2c(C3CNC3)cccc21.
What is the InChIKey of 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium?
The InChIKey is JIMMCMMDBIAHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-14-6-5-11-10(9-7-13-8-9)3-2-4-12(11)14/h2-4,9,13-14H,1,5-8H2.
What are the key properties of 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium?
4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium has a molecular weight of 188.27 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-1-methanidyl-2,3-dihydro-1H-indol-1-ium is sourced from PubChem (CID 166016888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).