C15H22N2O — CID 166016894
1-methanidyl-4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,3-dihydro-1H-indol-1-ium (PubChem CID 166016894) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-methanidyl-4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,3-dihydro-1H-indol-1-ium.
| Compound Name | 1-methanidyl-4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,3-dihydro-1H-indol-1-ium |
|---|---|
| PubChem CID | 166016894 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-methanidyl-4-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,3-dihydro-1H-indol-1-ium |
| SMILES | [CH2-][NH+]1CCc2c(CN3CC[C@H](OC)C3)cccc21 |
| InChI | InChI=1S/C15H22N2O/c1-16-8-7-14-12(4-3-5-15(14)16)10-17-9-6-13(11-17)18-2/h3-5,13,16H,1,6-11H2,2H3/t13-/m0/s1 |
| InChIKey | ASPZVEJGIXPYFH-ZDUSSCGKSA-N |
| XLogP | 0.77 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|