C13H13BrGeN2O — CID 166018520
(6-bromo-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-trimethylgermane (PubChem CID 166018520) has the molecular formula C13H13BrGeN2O and a molecular weight of 365.77 g/mol. Its IUPAC name is (6-bromo-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-trimethylgermane.
| Compound Name | (6-bromo-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-trimethylgermane |
|---|---|
| PubChem CID | 166018520 |
| Molecular Formula | C13H13BrGeN2O |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | (6-bromo-8-oxa-5,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-trimethylgermane |
| SMILES | C[Ge](C)(C)c1ccc2c(n1)oc1c(Br)nccc12 |
| InChI | InChI=1S/C13H13BrGeN2O/c1-15(2,3)10-5-4-9-8-6-7-16-12(14)11(8)18-13(9)17-10/h4-7H,1-3H3 |
| InChIKey | NYOFORKKYMAOMZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|