About 2-(1-chloroethenyl)-1,3,5-triiodobenzene
2-(1-chloroethenyl)-1,3,5-triiodobenzene (PubChem CID 166018920) has the molecular formula C8H4ClI3
and a molecular weight of 516.29 g/mol. Its IUPAC name is 2-(1-chloroethenyl)-1,3,5-triiodobenzene.
Molecular Properties
| Compound Name | 2-(1-chloroethenyl)-1,3,5-triiodobenzene |
| PubChem CID | 166018920 |
| Molecular Formula | C8H4ClI3 |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 515.71 |
| IUPAC Name | 2-(1-chloroethenyl)-1,3,5-triiodobenzene |
| SMILES | C=C(Cl)c1c(I)cc(I)cc1I |
| InChI | InChI=1S/C8H4ClI3/c1-4(9)8-6(11)2-5(10)3-7(8)12/h2-3H,1H2 |
| InChIKey | ZUBGCEYBVWHWIX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethenyl)-1,3,5-triiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethenyl)-1,3,5-triiodobenzene?
The IUPAC name of 2-(1-chloroethenyl)-1,3,5-triiodobenzene (CID 166018920) is 2-(1-chloroethenyl)-1,3,5-triiodobenzene.
What is the SMILES notation for 2-(1-chloroethenyl)-1,3,5-triiodobenzene?
The canonical SMILES for 2-(1-chloroethenyl)-1,3,5-triiodobenzene is C=C(Cl)c1c(I)cc(I)cc1I.
What is the InChIKey of 2-(1-chloroethenyl)-1,3,5-triiodobenzene?
The InChIKey is ZUBGCEYBVWHWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClI3/c1-4(9)8-6(11)2-5(10)3-7(8)12/h2-3H,1H2.
What are the key properties of 2-(1-chloroethenyl)-1,3,5-triiodobenzene?
2-(1-chloroethenyl)-1,3,5-triiodobenzene has a molecular weight of 516.29 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethenyl)-1,3,5-triiodobenzene is sourced from PubChem (CID 166018920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).