About 2,4,5-tri(propan-2-yl)-1,3-oxazolidine
2,4,5-tri(propan-2-yl)-1,3-oxazolidine (PubChem CID 166020016) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2,4,5-tri(propan-2-yl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2,4,5-tri(propan-2-yl)-1,3-oxazolidine |
| PubChem CID | 166020016 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2,4,5-tri(propan-2-yl)-1,3-oxazolidine |
| SMILES | CC(C)C1NC(C(C)C)C(C(C)C)O1 |
| InChI | InChI=1S/C12H25NO/c1-7(2)10-11(8(3)4)14-12(13-10)9(5)6/h7-13H,1-6H3 |
| InChIKey | JZGDVNNIQUTCIJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,5-tri(propan-2-yl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-tri(propan-2-yl)-1,3-oxazolidine?
The IUPAC name of 2,4,5-tri(propan-2-yl)-1,3-oxazolidine (CID 166020016) is 2,4,5-tri(propan-2-yl)-1,3-oxazolidine.
What is the SMILES notation for 2,4,5-tri(propan-2-yl)-1,3-oxazolidine?
The canonical SMILES for 2,4,5-tri(propan-2-yl)-1,3-oxazolidine is CC(C)C1NC(C(C)C)C(C(C)C)O1.
What is the InChIKey of 2,4,5-tri(propan-2-yl)-1,3-oxazolidine?
The InChIKey is JZGDVNNIQUTCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-7(2)10-11(8(3)4)14-12(13-10)9(5)6/h7-13H,1-6H3.
What are the key properties of 2,4,5-tri(propan-2-yl)-1,3-oxazolidine?
2,4,5-tri(propan-2-yl)-1,3-oxazolidine has a molecular weight of 199.34 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-tri(propan-2-yl)-1,3-oxazolidine is sourced from PubChem (CID 166020016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).