C19H34N2O2S2 — CID 166020060
6-(4-methylsulfonylcyclohexyl)-1-(thiolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine (PubChem CID 166020060) has the molecular formula C19H34N2O2S2 and a molecular weight of 386.63 g/mol. Its IUPAC name is 6-(4-methylsulfonylcyclohexyl)-1-(thiolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine.
| Compound Name | 6-(4-methylsulfonylcyclohexyl)-1-(thiolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 166020060 |
| Molecular Formula | C19H34N2O2S2 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-(4-methylsulfonylcyclohexyl)-1-(thiolan-2-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine |
| SMILES | CS(=O)(=O)C1CCC(C2CNC3CCN(CC4CCCS4)C3C2)CC1 |
| InChI | InChI=1S/C19H34N2O2S2/c1-25(22,23)17-6-4-14(5-7-17)15-11-19-18(20-12-15)8-9-21(19)13-16-3-2-10-24-16/h14-20H,2-13H2,1H3 |
| InChIKey | MCKZTJBQDICNKG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |