C18H33N3O2S2 — CID 166020190
5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethyl)-1,2,3a,4,5,6,7,7a-octahydroimidazo[4,5-b]pyridine (PubChem CID 166020190) has the molecular formula C18H33N3O2S2 and a molecular weight of 387.62 g/mol. Its IUPAC name is 5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethyl)-1,2,3a,4,5,6,7,7a-octahydroimidazo[4,5-b]pyridine.
| Compound Name | 5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethyl)-1,2,3a,4,5,6,7,7a-octahydroimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 166020190 |
| Molecular Formula | C18H33N3O2S2 |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethyl)-1,2,3a,4,5,6,7,7a-octahydroimidazo[4,5-b]pyridine |
| SMILES | CS(=O)(=O)C1CCC(C2CCC3NCN(CC4CCCS4)C3N2)CC1 |
| InChI | InChI=1S/C18H33N3O2S2/c1-25(22,23)15-6-4-13(5-7-15)16-8-9-17-18(20-16)21(12-19-17)11-14-3-2-10-24-14/h13-20H,2-12H2,1H3 |
| InChIKey | KWFAZWXLQWPJLI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |