About 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol
1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol (PubChem CID 166020737) has the molecular formula C13H8Br2ClNO
and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol.
Molecular Properties
| Compound Name | 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol |
| PubChem CID | 166020737 |
| Molecular Formula | C13H8Br2ClNO |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol |
| SMILES | OC(=Cc1c(Br)cccc1Br)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H8Br2ClNO/c14-10-2-1-3-11(15)9(10)6-13(18)12-5-4-8(16)7-17-12/h1-7,18H |
| InChIKey | QZJYSIYDUMRTAD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol?
The IUPAC name of 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol (CID 166020737) is 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol.
What is the SMILES notation for 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol?
The canonical SMILES for 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol is OC(=Cc1c(Br)cccc1Br)c1ccc(Cl)cn1.
What is the InChIKey of 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol?
The InChIKey is QZJYSIYDUMRTAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2ClNO/c14-10-2-1-3-11(15)9(10)6-13(18)12-5-4-8(16)7-17-12/h1-7,18H.
What are the key properties of 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol?
1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol has a molecular weight of 389.47 g/mol, XLogP of 5.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2-pyridinyl)-2-(2,6-dibromophenyl)ethenol is sourced from PubChem (CID 166020737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).