C73H85N — CID 166021012
N,9,9-tris(4-cyclohexylphenyl)-N-[4-(3,4,5-tritert-butylphenyl)phenyl]fluoren-2-amine (PubChem CID 166021012) has the molecular formula C73H85N and a molecular weight of 976.49 g/mol. Its IUPAC name is N,9,9-tris(4-cyclohexylphenyl)-N-[4-(3,4,5-tritert-butylphenyl)phenyl]fluoren-2-amine.
| Compound Name | N,9,9-tris(4-cyclohexylphenyl)-N-[4-(3,4,5-tritert-butylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 166021012 |
| Molecular Formula | C73H85N |
| Molecular Weight | 976.49 g/mol |
| Exact Mass | 975.67 |
| IUPAC Name | N,9,9-tris(4-cyclohexylphenyl)-N-[4-(3,4,5-tritert-butylphenyl)phenyl]fluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc(N(c3ccc(C4CCCCC4)cc3)c3ccc4c(c3)C(c3ccc(C5CCCCC5)cc3)(c3ccc(C5CCCCC5)cc3)c3ccccc3-4)cc2)cc(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C73H85N/c1-70(2,3)67-47-57(48-68(71(4,5)6)69(67)72(7,8)9)56-35-43-61(44-36-56)74(60-41-33-55(34-42-60)52-25-17-12-18-26-52)62-45-46-64-63-27-19-20-28-65(63)73(66(64)49-62,58-37-29-53(30-38-58)50-21-13-10-14-22-50)59-39-31-54(32-40-59)51-23-15-11-16-24-51/h19-20,27-52H,10-18,21-26H2,1-9H3 |
| InChIKey | TWIDBHRMQRIDSD-UHFFFAOYSA-N |
| XLogP | 21.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.49 |
| LogP ≤ 5 | 21.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |