About [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol
[2-(ethoxymethoxy)-3,5-diiodophenyl]methanol (PubChem CID 166021552) has the molecular formula C10H12I2O3
and a molecular weight of 434.01 g/mol. Its IUPAC name is [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol.
Molecular Properties
| Compound Name | [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol |
| PubChem CID | 166021552 |
| Molecular Formula | C10H12I2O3 |
| Molecular Weight | 434.01 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol |
| SMILES | CCOCOc1c(I)cc(I)cc1CO |
| InChI | InChI=1S/C10H12I2O3/c1-2-14-6-15-10-7(5-13)3-8(11)4-9(10)12/h3-4,13H,2,5-6H2,1H3 |
| InChIKey | ZJLLBYFGEXKUFP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.01 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol?
The IUPAC name of [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol (CID 166021552) is [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol.
What is the SMILES notation for [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol?
The canonical SMILES for [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol is CCOCOc1c(I)cc(I)cc1CO.
What is the InChIKey of [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol?
The InChIKey is ZJLLBYFGEXKUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12I2O3/c1-2-14-6-15-10-7(5-13)3-8(11)4-9(10)12/h3-4,13H,2,5-6H2,1H3.
What are the key properties of [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol?
[2-(ethoxymethoxy)-3,5-diiodophenyl]methanol has a molecular weight of 434.01 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(ethoxymethoxy)-3,5-diiodophenyl]methanol is sourced from PubChem (CID 166021552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).