About N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide
N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide (PubChem CID 166021780) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide |
| PubChem CID | 166021780 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide |
| SMILES | CNC(=O)c1ncc(C(C)C)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-5(2)6-4-10-8(12-6)7(11)9-3/h4-5H,1-3H3,(H,9,11) |
| InChIKey | ZBKBLMJJPPJTNZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide?
The IUPAC name of N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide (CID 166021780) is N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide is CNC(=O)c1ncc(C(C)C)s1.
What is the InChIKey of N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide?
The InChIKey is ZBKBLMJJPPJTNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-5(2)6-4-10-8(12-6)7(11)9-3/h4-5H,1-3H3,(H,9,11).
What are the key properties of N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide?
N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide has a molecular weight of 184.26 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-propan-2-yl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 166021780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).