About (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one
(2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one (PubChem CID 166023523) has the molecular formula C16H12BrNO4S
and a molecular weight of 394.25 g/mol. Its IUPAC name is (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one.
Molecular Properties
| Compound Name | (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one |
| PubChem CID | 166023523 |
| Molecular Formula | C16H12BrNO4S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one |
| SMILES | COCOc1cc(Br)c(/C=C2\Sc3ncccc3C2=O)cc1O |
| InChI | InChI=1S/C16H12BrNO4S/c1-21-8-22-13-7-11(17)9(5-12(13)19)6-14-15(20)10-3-2-4-18-16(10)23-14/h2-7,19H,8H2,1H3/b14-6- |
| InChIKey | BGECGLLTUGKYMB-NSIKDUERSA-N |
| XLogP | 3.86 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one?
The IUPAC name of (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one (CID 166023523) is (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one.
What is the SMILES notation for (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one?
The canonical SMILES for (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one is COCOc1cc(Br)c(/C=C2\Sc3ncccc3C2=O)cc1O.
What is the InChIKey of (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one?
The InChIKey is BGECGLLTUGKYMB-NSIKDUERSA-N. The full InChI is InChI=1S/C16H12BrNO4S/c1-21-8-22-13-7-11(17)9(5-12(13)19)6-14-15(20)10-3-2-4-18-16(10)23-14/h2-7,19H,8H2,1H3/b14-6-.
What are the key properties of (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one?
(2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one has a molecular weight of 394.25 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[[2-bromo-5-hydroxy-4-(methoxymethoxy)phenyl]methylidene]thieno[2,3-b]pyridin-3-one is sourced from PubChem (CID 166023523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).