C14H10F3N3O3 — CID 166023658
3-[3-(3,4,5-trifluorophenoxy)azetidin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 166023658) has the molecular formula C14H10F3N3O3 and a molecular weight of 325.25 g/mol. Its IUPAC name is 3-[3-(3,4,5-trifluorophenoxy)azetidin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 3-[3-(3,4,5-trifluorophenoxy)azetidin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 166023658 |
| Molecular Formula | C14H10F3N3O3 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-[3-(3,4,5-trifluorophenoxy)azetidin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1N1CC(Oc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H10F3N3O3/c15-9-3-7(4-10(16)11(9)17)23-8-5-20(6-8)13-12(14(21)22)18-1-2-19-13/h1-4,8H,5-6H2,(H,21,22) |
| InChIKey | KFAAUGNBBCJPIX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|