C12H16N4O3S — CID 166024027
4-N-(1-ethyl-6-oxo-3-pyridinyl)-1,3-thiazolidine-2,4-dicarboxamide (PubChem CID 166024027) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-N-(1-ethyl-6-oxo-3-pyridinyl)-1,3-thiazolidine-2,4-dicarboxamide.
| Compound Name | 4-N-(1-ethyl-6-oxo-3-pyridinyl)-1,3-thiazolidine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 166024027 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-N-(1-ethyl-6-oxo-3-pyridinyl)-1,3-thiazolidine-2,4-dicarboxamide |
| SMILES | CCn1cc(NC(=O)C2CSC(C(N)=O)N2)ccc1=O |
| InChI | InChI=1S/C12H16N4O3S/c1-2-16-5-7(3-4-9(16)17)14-11(19)8-6-20-12(15-8)10(13)18/h3-5,8,12,15H,2,6H2,1H3,(H2,13,18)(H,14,19) |
| InChIKey | CFEQDNDDKUPKFJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |