C24H20BrNO3 — CID 166024578
[3-(2-bromophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)benzoate (PubChem CID 166024578) has the molecular formula C24H20BrNO3 and a molecular weight of 450.33 g/mol. Its IUPAC name is [3-(2-bromophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)benzoate.
| Compound Name | [3-(2-bromophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)benzoate |
|---|---|
| PubChem CID | 166024578 |
| Molecular Formula | C24H20BrNO3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | [3-(2-bromophenyl)-1,2-oxazol-5-yl]methyl 4-(2-cyclopentylethynyl)benzoate |
| SMILES | O=C(OCc1cc(-c2ccccc2Br)no1)c1ccc(C#CC2CCCC2)cc1 |
| InChI | InChI=1S/C24H20BrNO3/c25-22-8-4-3-7-21(22)23-15-20(29-26-23)16-28-24(27)19-13-11-18(12-14-19)10-9-17-5-1-2-6-17/h3-4,7-8,11-15,17H,1-2,5-6,16H2 |
| InChIKey | WZTJYSBNABOJKL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|