C24H17F5N3O+ — CID 166025016
[(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethanol (PubChem CID 166025016) has the molecular formula C24H17F5N3O+ and a molecular weight of 458.41 g/mol. Its IUPAC name is [(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethanol.
| Compound Name | [(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 166025016 |
| Molecular Formula | C24H17F5N3O+ |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)[C@H]1CCc2nn(-c3c(F)c(F)c(F)c(F)c3F)c[n+]21 |
| InChI | InChI=1S/C24H17F5N3O/c25-18-19(26)21(28)23(22(29)20(18)27)32-13-31-16(11-12-17(31)30-32)24(33,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,13,16,33H,11-12H2/q+1/t16-/m1/s1 |
| InChIKey | VYGWIZIUNMGOOL-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|