C27H25F5N3OSi+ — CID 166025052
trimethyl-[[(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethoxy]silane (PubChem CID 166025052) has the molecular formula C27H25F5N3OSi+ and a molecular weight of 530.59 g/mol. Its IUPAC name is trimethyl-[[(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethoxy]silane.
| Compound Name | trimethyl-[[(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethoxy]silane |
|---|---|
| PubChem CID | 166025052 |
| Molecular Formula | C27H25F5N3OSi+ |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | trimethyl-[[(5R)-2-(2,3,4,5,6-pentafluorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]-diphenylmethoxy]silane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@H]1CCc2nn(-c3c(F)c(F)c(F)c(F)c3F)c[n+]21 |
| InChI | InChI=1S/C27H25F5N3OSi/c1-37(2,3)36-27(17-10-6-4-7-11-17,18-12-8-5-9-13-18)19-14-15-20-33-35(16-34(19)20)26-24(31)22(29)21(28)23(30)25(26)32/h4-13,16,19H,14-15H2,1-3H3/q+1/t19-/m1/s1 |
| InChIKey | VRBYLYRTZYAPIG-LJQANCHMSA-N |
| XLogP | 6.14 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|