About (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid
(3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid (PubChem CID 166025482) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid.
Analyze (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
The IUPAC name of (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid (CID 166025482) is (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid.
What is the SMILES notation for (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
The canonical SMILES for (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid is Cc1ncc([C@@H](CC(=O)O)C2CC2)s1.
What is the InChIKey of (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
The InChIKey is SHJVJPJRLJPXGN-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-6-11-5-9(14-6)8(4-10(12)13)7-2-3-7/h5,7-8H,2-4H2,1H3,(H,12,13)/t8-/m0/s1.
What are the key properties of (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid?
(3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid has a molecular weight of 211.29 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-cyclopropyl-3-(2-methyl-1,3-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 166025482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).