C23H39NO5Si — CID 166026445
3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-tri(propan-2-yl)silyloxyphenyl]propanoic acid (PubChem CID 166026445) has the molecular formula C23H39NO5Si and a molecular weight of 437.65 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-tri(propan-2-yl)silyloxyphenyl]propanoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-tri(propan-2-yl)silyloxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 166026445 |
| Molecular Formula | C23H39NO5Si |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-tri(propan-2-yl)silyloxyphenyl]propanoic acid |
| SMILES | CC(C)[Si](Oc1ccc(C(CNC(=O)OC(C)(C)C)C(=O)O)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H39NO5Si/c1-15(2)30(16(3)4,17(5)6)29-19-12-10-18(11-13-19)20(21(25)26)14-24-22(27)28-23(7,8)9/h10-13,15-17,20H,14H2,1-9H3,(H,24,27)(H,25,26) |
| InChIKey | BGWPIFHOOFNKJH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|