About 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane
8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 166027392) has the molecular formula C23H24F2O4S
and a molecular weight of 434.50 g/mol. Its IUPAC name is 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 166027392 |
| Molecular Formula | C23H24F2O4S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccc(-c2ccc(F)cc2F)cc1)C1(C2CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C23H24F2O4S/c24-18-3-6-20(21(25)15-18)16-1-4-19(5-2-16)30(26,27)22(11-12-22)17-7-9-23(10-8-17)28-13-14-29-23/h1-6,15,17H,7-14H2 |
| InChIKey | WLYFPKMRSMFDSR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane (CID 166027392) is 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane is O=S(=O)(c1ccc(-c2ccc(F)cc2F)cc1)C1(C2CCC3(CC2)OCCO3)CC1.
What is the InChIKey of 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane?
The InChIKey is WLYFPKMRSMFDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F2O4S/c24-18-3-6-20(21(25)15-18)16-1-4-19(5-2-16)30(26,27)22(11-12-22)17-7-9-23(10-8-17)28-13-14-29-23/h1-6,15,17H,7-14H2.
What are the key properties of 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane?
8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane has a molecular weight of 434.50 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[1-[4-(2,4-difluorophenyl)phenyl]sulfonylcyclopropyl]-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 166027392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).