C23H29N5O2 — CID 166027524
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylbutoxy)-4-(1-methylpyrazol-4-yl)benzamide (PubChem CID 166027524) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylbutoxy)-4-(1-methylpyrazol-4-yl)benzamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylbutoxy)-4-(1-methylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 166027524 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylbutoxy)-4-(1-methylpyrazol-4-yl)benzamide |
| SMILES | CCC(C)COc1cc(C(=O)N[C@@H]2C[C@@H]3CC[C@H]2N3C#N)ccc1-c1cnn(C)c1 |
| InChI | InChI=1S/C23H29N5O2/c1-4-15(2)13-30-22-9-16(5-7-19(22)17-11-25-27(3)12-17)23(29)26-20-10-18-6-8-21(20)28(18)14-24/h5,7,9,11-12,15,18,20-21H,4,6,8,10,13H2,1-3H3,(H,26,29)/t15?,18-,20+,21+/m0/s1 |
| InChIKey | QUDRTENPNWICQE-NBUPCJOWSA-N |
| XLogP | 3.33 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|