C23H26N6O2 — CID 166027578
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-(2-methyl-2-phenylmorpholin-4-yl)pyrimidine-4-carboxamide (PubChem CID 166027578) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-(2-methyl-2-phenylmorpholin-4-yl)pyrimidine-4-carboxamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-(2-methyl-2-phenylmorpholin-4-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166027578 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-6-(2-methyl-2-phenylmorpholin-4-yl)pyrimidine-4-carboxamide |
| SMILES | CC1(c2ccccc2)CN(c2cc(C(=O)N[C@@H]3C[C@@H]4CC[C@H]3N4C#N)ncn2)CCO1 |
| InChI | InChI=1S/C23H26N6O2/c1-23(16-5-3-2-4-6-16)13-28(9-10-31-23)21-12-19(25-15-26-21)22(30)27-18-11-17-7-8-20(18)29(17)14-24/h2-6,12,15,17-18,20H,7-11,13H2,1H3,(H,27,30)/t17-,18+,20+,23?/m0/s1 |
| InChIKey | QXHAOPHITPQGDT-VCUVOWSBSA-N |
| XLogP | 2.04 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|