C10H14BNO5 — CID 166027642
(3aR,5S,6R,6aR)-6-ethenyl-6-iminoboranyloxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 166027642) has the molecular formula C10H14BNO5 and a molecular weight of 239.04 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-6-ethenyl-6-iminoboranyloxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aR,5S,6R,6aR)-6-ethenyl-6-iminoboranyloxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 166027642 |
| Molecular Formula | C10H14BNO5 |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | (3aR,5S,6R,6aR)-6-ethenyl-6-iminoboranyloxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | [H]/N=B/O[C@]1(C=C)[C@@H](C=O)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C10H14BNO5/c1-4-10(17-11-12)6(5-13)14-8-7(10)15-9(2,3)16-8/h4-8,12H,1H2,2-3H3/t6-,7+,8-,10-/m1/s1 |
| InChIKey | CKYVVBRFOANABU-IBCQBUCCSA-N |
| XLogP | 0.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|