C20H17N5O2S2 — CID 166028221
2-[6-[amino(1,3-benzothiazol-2-yl)amino]-3,4-dihydro-2H-quinolin-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 166028221) has the molecular formula C20H17N5O2S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[6-[amino(1,3-benzothiazol-2-yl)amino]-3,4-dihydro-2H-quinolin-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[6-[amino(1,3-benzothiazol-2-yl)amino]-3,4-dihydro-2H-quinolin-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166028221 |
| Molecular Formula | C20H17N5O2S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-[6-[amino(1,3-benzothiazol-2-yl)amino]-3,4-dihydro-2H-quinolin-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NN(c1ccc2c(c1)CCCN2c1nc(C(=O)O)cs1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H17N5O2S2/c21-25(20-22-14-5-1-2-6-17(14)29-20)13-7-8-16-12(10-13)4-3-9-24(16)19-23-15(11-28-19)18(26)27/h1-2,5-8,10-11H,3-4,9,21H2,(H,26,27) |
| InChIKey | ONEGOXGAVXUWCC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|