C40H41FN6O2S2 — CID 166028234
2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[4-[2-fluoro-4-(4-methyldeca-8,9-dien-1-ynyl)phenyl]butyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 166028234) has the molecular formula C40H41FN6O2S2 and a molecular weight of 720.94 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[4-[2-fluoro-4-(4-methyldeca-8,9-dien-1-ynyl)phenyl]butyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[4-[2-fluoro-4-(4-methyldeca-8,9-dien-1-ynyl)phenyl]butyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166028234 |
| Molecular Formula | C40H41FN6O2S2 |
| Molecular Weight | 720.94 g/mol |
| Exact Mass | 720.27 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-ylamino)-4-methyl-6,7-dihydro-5H-pyrido[2,3-c]pyridazin-8-yl]-5-[4-[2-fluoro-4-(4-methyldeca-8,9-dien-1-ynyl)phenyl]butyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C=C=CCCCC(C)CC#Cc1ccc(CCCCc2sc(N3CCCc4c3nnc(Nc3nc5ccccc5s3)c4C)nc2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C40H41FN6O2S2/c1-4-5-6-7-14-26(2)15-12-16-28-22-23-29(31(41)25-28)17-8-10-21-34-35(38(48)49)43-40(51-34)47-24-13-18-30-27(3)36(45-46-37(30)47)44-39-42-32-19-9-11-20-33(32)50-39/h5,9,11,19-20,22-23,25-26H,1,6-8,10,13-15,17-18,21,24H2,2-3H3,(H,48,49)(H,42,44,45) |
| InChIKey | UMLLEHMXXKCCJL-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.94 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|