C46H40BN5O — CID 166028815
6-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-1,2-dimethyl-7-(2-phenylphenyl)imidazo[4,5-c]azaborinine (PubChem CID 166028815) has the molecular formula C46H40BN5O and a molecular weight of 689.67 g/mol. Its IUPAC name is 6-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-1,2-dimethyl-7-(2-phenylphenyl)imidazo[4,5-c]azaborinine.
| Compound Name | 6-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-1,2-dimethyl-7-(2-phenylphenyl)imidazo[4,5-c]azaborinine |
|---|---|
| PubChem CID | 166028815 |
| Molecular Formula | C46H40BN5O |
| Molecular Weight | 689.67 g/mol |
| Exact Mass | 689.33 |
| IUPAC Name | 6-[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxyphenyl]-1,2-dimethyl-7-(2-phenylphenyl)imidazo[4,5-c]azaborinine |
| SMILES | CB1c2c(nc(-c3cccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)n2-c2ccccc2-c2ccccc2)C=CN1C |
| InChI | InChI=1S/C46H40BN5O/c1-46(2,3)33-24-26-48-43(29-33)51-41-21-12-10-19-37(41)38-23-22-35(30-42(38)51)53-34-17-13-16-32(28-34)45-49-39-25-27-50(5)47(4)44(39)52(45)40-20-11-9-18-36(40)31-14-7-6-8-15-31/h6-30H,1-5H3 |
| InChIKey | YNSBKRDNIVXHCS-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.67 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|