C15H20N+ — CID 166028844
6-(2,5-dimethylphenyl)-1,5-dimethyl-2,3-dihydropyridin-1-ium (PubChem CID 166028844) has the molecular formula C15H20N+ and a molecular weight of 214.33 g/mol. Its IUPAC name is 6-(2,5-dimethylphenyl)-1,5-dimethyl-2,3-dihydropyridin-1-ium.
| Compound Name | 6-(2,5-dimethylphenyl)-1,5-dimethyl-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 166028844 |
| Molecular Formula | C15H20N+ |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 6-(2,5-dimethylphenyl)-1,5-dimethyl-2,3-dihydropyridin-1-ium |
| SMILES | CC1=CCC[N+](C)=C1c1cc(C)ccc1C |
| InChI | InChI=1S/C15H20N/c1-11-7-8-12(2)14(10-11)15-13(3)6-5-9-16(15)4/h6-8,10H,5,9H2,1-4H3/q+1 |
| InChIKey | NRAURJBIDAYBEJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|