C22H20Cl2N2O2 — CID 16602961
1-[(2-chlorophenyl)methyl]-N-[1-(4-chlorophenyl)propyl]-6-oxopyridine-3-carboxamide (PubChem CID 16602961) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[1-(4-chlorophenyl)propyl]-6-oxopyridine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[1-(4-chlorophenyl)propyl]-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 16602961 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[1-(4-chlorophenyl)propyl]-6-oxopyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(=O)n(Cc2ccccc2Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O2/c1-2-20(15-7-10-18(23)11-8-15)25-22(28)17-9-12-21(27)26(14-17)13-16-5-3-4-6-19(16)24/h3-12,14,20H,2,13H2,1H3,(H,25,28) |
| InChIKey | PDQXFEWGGORKGU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |