C26H22FN2+ — CID 166029975
19-fluoro-5,6,10,11,14-pentamethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene (PubChem CID 166029975) has the molecular formula C26H22FN2+ and a molecular weight of 381.47 g/mol. Its IUPAC name is 19-fluoro-5,6,10,11,14-pentamethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene.
| Compound Name | 19-fluoro-5,6,10,11,14-pentamethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
|---|---|
| PubChem CID | 166029975 |
| Molecular Formula | C26H22FN2+ |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 19-fluoro-5,6,10,11,14-pentamethyl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaene |
| SMILES | Cc1ccc2c(c1C)c1cc(C)c(C)c3c1n2c1cc(F)cc2cc[n+](C)c3c21 |
| InChI | InChI=1S/C26H22FN2/c1-13-6-7-20-22(15(13)3)19-10-14(2)16(4)23-25(19)29(20)21-12-18(27)11-17-8-9-28(5)26(23)24(17)21/h6-12H,1-5H3/q+1 |
| InChIKey | SEJCWFSQLXWJJT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|