About CID 166030339
CID 166030339 (PubChem CID 166030339) has the molecular formula C47H61IrN2O2-
and a molecular weight of 878.23 g/mol.
Molecular Properties
| Compound Name | CID 166030339 |
| PubChem CID | 166030339 |
| Molecular Formula | C47H61IrN2O2- |
| Molecular Weight | 878.23 g/mol |
| Exact Mass | 878.44 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1[c-]c2c3nccc4cc(CC(C)(C)C)cc(c43)n3c4cc(CC(C)(C)C)ccc4c(c1)c23.[Ir] |
| InChI | InChI=1S/C32H33N2.C15H28O2.Ir/c1-19-12-24-23-9-8-20(17-31(2,3)4)15-26(23)34-27-16-21(18-32(5,6)7)14-22-10-11-33-29(28(22)27)25(13-19)30(24)34;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h8-12,14-16H,17-18H2,1-7H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | AKSYSDYTOLTPHQ-SWPBDETKSA-N |
| XLogP | 13.32 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 878.23 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 166030339 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166030339?
The IUPAC name of CID 166030339 (CID 166030339) is not available.
What is the SMILES notation for CID 166030339?
The canonical SMILES for CID 166030339 is CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1[c-]c2c3nccc4cc(CC(C)(C)C)cc(c43)n3c4cc(CC(C)(C)C)ccc4c(c1)c23.[Ir].
What is the InChIKey of CID 166030339?
The InChIKey is AKSYSDYTOLTPHQ-SWPBDETKSA-N. The full InChI is InChI=1S/C32H33N2.C15H28O2.Ir/c1-19-12-24-23-9-8-20(17-31(2,3)4)15-26(23)34-27-16-21(18-32(5,6)7)14-22-10-11-33-29(28(22)27)25(13-19)30(24)34;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h8-12,14-16H,17-18H2,1-7H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;.
What are the key properties of CID 166030339?
CID 166030339 has a molecular weight of 878.23 g/mol, XLogP of 13.32, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166030339 is sourced from PubChem (CID 166030339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).