C33H39N2Si+ — CID 166030451
triethyl-(10,11,14-trimethyl-4-propan-2-yl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)silane (PubChem CID 166030451) has the molecular formula C33H39N2Si+ and a molecular weight of 491.78 g/mol. Its IUPAC name is triethyl-(10,11,14-trimethyl-4-propan-2-yl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)silane.
| Compound Name | triethyl-(10,11,14-trimethyl-4-propan-2-yl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)silane |
|---|---|
| PubChem CID | 166030451 |
| Molecular Formula | C33H39N2Si+ |
| Molecular Weight | 491.78 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | triethyl-(10,11,14-trimethyl-4-propan-2-yl-1-aza-14-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17,19,21(23)-undecaen-19-yl)silane |
| SMILES | CC[Si](CC)(CC)c1cc2cc[n+](C)c3c4c(C)c(C)cc5c6ccc(C(C)C)cc6n(c(c1)c23)c54 |
| InChI | InChI=1S/C33H39N2Si/c1-9-36(10-2,11-3)25-17-24-14-15-34(8)33-30-22(7)21(6)16-27-26-13-12-23(20(4)5)18-28(26)35(32(27)30)29(19-25)31(24)33/h12-20H,9-11H2,1-8H3/q+1 |
| InChIKey | AMJWFWWGRYSRPC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.78 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|