C23H25ClF2N4O2S — CID 166030570
2-chloro-4-[5-[1-(4,4-difluorocyclohexanecarbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-thiadiazol-2-yl]-N,N-dimethylbenzamide (PubChem CID 166030570) has the molecular formula C23H25ClF2N4O2S and a molecular weight of 495.00 g/mol. Its IUPAC name is 2-chloro-4-[5-[1-(4,4-difluorocyclohexanecarbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-thiadiazol-2-yl]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-4-[5-[1-(4,4-difluorocyclohexanecarbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-thiadiazol-2-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 166030570 |
| Molecular Formula | C23H25ClF2N4O2S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-chloro-4-[5-[1-(4,4-difluorocyclohexanecarbonyl)-3,6-dihydro-2H-pyridin-4-yl]-1,3,4-thiadiazol-2-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2nnc(C3=CCN(C(=O)C4CCC(F)(F)CC4)CC3)s2)cc1Cl |
| InChI | InChI=1S/C23H25ClF2N4O2S/c1-29(2)22(32)17-4-3-16(13-18(17)24)20-28-27-19(33-20)14-7-11-30(12-8-14)21(31)15-5-9-23(25,26)10-6-15/h3-4,7,13,15H,5-6,8-12H2,1-2H3 |
| InChIKey | WIMIXFCPGZEAKU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |