C30H23NO2S — CID 166031026
5-[(4-spiro[acridine-9,1'-cyclopentane]-10-ylcyclopenta-1,3-dien-1-yl)methylidene]cyclopenta[c]thiophene-4,6-dione (PubChem CID 166031026) has the molecular formula C30H23NO2S and a molecular weight of 461.59 g/mol. Its IUPAC name is 5-[(4-spiro[acridine-9,1'-cyclopentane]-10-ylcyclopenta-1,3-dien-1-yl)methylidene]cyclopenta[c]thiophene-4,6-dione.
| Compound Name | 5-[(4-spiro[acridine-9,1'-cyclopentane]-10-ylcyclopenta-1,3-dien-1-yl)methylidene]cyclopenta[c]thiophene-4,6-dione |
|---|---|
| PubChem CID | 166031026 |
| Molecular Formula | C30H23NO2S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 5-[(4-spiro[acridine-9,1'-cyclopentane]-10-ylcyclopenta-1,3-dien-1-yl)methylidene]cyclopenta[c]thiophene-4,6-dione |
| SMILES | O=C1C(=CC2=CC=C(N3c4ccccc4C4(CCCC4)c4ccccc43)C2)C(=O)c2cscc21 |
| InChI | InChI=1S/C30H23NO2S/c32-28-21(29(33)23-18-34-17-22(23)28)16-19-11-12-20(15-19)31-26-9-3-1-7-24(26)30(13-5-6-14-30)25-8-2-4-10-27(25)31/h1-4,7-12,16-18H,5-6,13-15H2 |
| InChIKey | RBIJBNNKNGAZJA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|