C63H57NO — CID 166032355
N-[16,17-bis(4-tert-butylphenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaenyl]-N-(5-tert-butyl-2-methylphenyl)dibenzofuran-4-amine (PubChem CID 166032355) has the molecular formula C63H57NO and a molecular weight of 844.16 g/mol. Its IUPAC name is N-[16,17-bis(4-tert-butylphenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaenyl]-N-(5-tert-butyl-2-methylphenyl)dibenzofuran-4-amine.
| Compound Name | N-[16,17-bis(4-tert-butylphenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaenyl]-N-(5-tert-butyl-2-methylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 166032355 |
| Molecular Formula | C63H57NO |
| Molecular Weight | 844.16 g/mol |
| Exact Mass | 843.44 |
| IUPAC Name | N-[16,17-bis(4-tert-butylphenyl)-6-pentacyclo[10.8.0.02,11.04,9.014,19]icosa-1(20),2(11),3,5,7,9,12,14,16,18-decaenyl]-N-(5-tert-butyl-2-methylphenyl)dibenzofuran-4-amine |
| SMILES | Cc1ccc(C(C)(C)C)cc1N(c1ccc2cc3c(cc2c1)-c1cc2cc(-c4ccc(C(C)(C)C)cc4)c(-c4ccc(C(C)(C)C)cc4)cc2cc1-3)c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C63H57NO/c1-38-18-24-47(63(8,9)10)37-58(38)64(57-16-13-15-50-49-14-11-12-17-59(49)65-60(50)57)48-29-23-41-31-53-54(34-42(41)30-48)56-36-44-33-52(40-21-27-46(28-22-40)62(5,6)7)51(32-43(44)35-55(53)56)39-19-25-45(26-20-39)61(2,3)4/h11-37H,1-10H3 |
| InChIKey | FGZKRBZLAJZZDY-UHFFFAOYSA-N |
| XLogP | 18.54 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.16 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |