About CID 166033837
CID 166033837 (PubChem CID 166033837) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol.
Molecular Properties
| Compound Name | CID 166033837 |
| PubChem CID | 166033837 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | — |
| SMILES | CCC(C)[C]1[C]2[C](C)[C](C)[C]2[C]1C(C)CC |
| InChI | InChI=1S/C16H24/c1-7-9(3)13-14(10(4)8-2)16-12(6)11(5)15(13)16/h9-10H,7-8H2,1-6H3 |
| InChIKey | VRJJVHUTAOOPEM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 166033837 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166033837?
The IUPAC name of CID 166033837 (CID 166033837) is not available.
What is the SMILES notation for CID 166033837?
The canonical SMILES for CID 166033837 is CCC(C)[C]1[C]2[C](C)[C](C)[C]2[C]1C(C)CC.
What is the InChIKey of CID 166033837?
The InChIKey is VRJJVHUTAOOPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-7-9(3)13-14(10(4)8-2)16-12(6)11(5)15(13)16/h9-10H,7-8H2,1-6H3.
What are the key properties of CID 166033837?
CID 166033837 has a molecular weight of 216.37 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166033837 is sourced from PubChem (CID 166033837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).