C22H26Cl2N4O3 — CID 166034001
3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2-methylpropyl)piperazin-1-yl]-3-oxopropanoic acid (PubChem CID 166034001) has the molecular formula C22H26Cl2N4O3 and a molecular weight of 465.38 g/mol. Its IUPAC name is 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2-methylpropyl)piperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2-methylpropyl)piperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 166034001 |
| Molecular Formula | C22H26Cl2N4O3 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2-methylpropyl)piperazin-1-yl]-3-oxopropanoic acid |
| SMILES | CC(C)C[C@H]1CN(C(=O)CC(=O)O)C[C@@H](c2ccc(Cl)cc2)N1c1ncc(Cl)cc1N |
| InChI | InChI=1S/C22H26Cl2N4O3/c1-13(2)7-17-11-27(20(29)9-21(30)31)12-19(14-3-5-15(23)6-4-14)28(17)22-18(25)8-16(24)10-26-22/h3-6,8,10,13,17,19H,7,9,11-12,25H2,1-2H3,(H,30,31)/t17-,19-/m0/s1 |
| InChIKey | BCURZNRLBFGNAN-HKUYNNGSSA-N |
| XLogP | 4.25 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|