C23H28Cl2N4O3 — CID 166034014
3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2,2-dimethylpropyl)piperazin-1-yl]-3-oxopropanoic acid (PubChem CID 166034014) has the molecular formula C23H28Cl2N4O3 and a molecular weight of 479.41 g/mol. Its IUPAC name is 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2,2-dimethylpropyl)piperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2,2-dimethylpropyl)piperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 166034014 |
| Molecular Formula | C23H28Cl2N4O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(2,2-dimethylpropyl)piperazin-1-yl]-3-oxopropanoic acid |
| SMILES | CC(C)(C)C[C@H]1CN(C(=O)CC(=O)O)C[C@@H](c2ccc(Cl)cc2)N1c1ncc(Cl)cc1N |
| InChI | InChI=1S/C23H28Cl2N4O3/c1-23(2,3)10-17-12-28(20(30)9-21(31)32)13-19(14-4-6-15(24)7-5-14)29(17)22-18(26)8-16(25)11-27-22/h4-8,11,17,19H,9-10,12-13,26H2,1-3H3,(H,31,32)/t17-,19-/m0/s1 |
| InChIKey | DHNNFPMNWVKVKV-HKUYNNGSSA-N |
| XLogP | 4.64 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|