C24H28Cl2N4O3 — CID 166034039
3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(cyclopentylmethyl)piperazin-1-yl]-3-oxopropanoic acid (PubChem CID 166034039) has the molecular formula C24H28Cl2N4O3 and a molecular weight of 491.42 g/mol. Its IUPAC name is 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(cyclopentylmethyl)piperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(cyclopentylmethyl)piperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 166034039 |
| Molecular Formula | C24H28Cl2N4O3 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 3-[(3R,5S)-4-(3-amino-5-chloro-2-pyridinyl)-3-(4-chlorophenyl)-5-(cyclopentylmethyl)piperazin-1-yl]-3-oxopropanoic acid |
| SMILES | Nc1cc(Cl)cnc1N1[C@@H](CC2CCCC2)CN(C(=O)CC(=O)O)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28Cl2N4O3/c25-17-7-5-16(6-8-17)21-14-29(22(31)11-23(32)33)13-19(9-15-3-1-2-4-15)30(21)24-20(27)10-18(26)12-28-24/h5-8,10,12,15,19,21H,1-4,9,11,13-14,27H2,(H,32,33)/t19-,21-/m0/s1 |
| InChIKey | QPJGRJUFWMMHTA-FPOVZHCZSA-N |
| XLogP | 4.78 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|