C19H16N4 — CID 166034655
5-[5-(isocyanomethyl)-1H-indol-3-yl]spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane] (PubChem CID 166034655) has the molecular formula C19H16N4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 5-[5-(isocyanomethyl)-1H-indol-3-yl]spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane].
| Compound Name | 5-[5-(isocyanomethyl)-1H-indol-3-yl]spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 166034655 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5-[5-(isocyanomethyl)-1H-indol-3-yl]spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane] |
| SMILES | [C-]#[N+]Cc1ccc2[nH]cc(-c3cnc4c(c3)C3(CC3)CN4)c2c1 |
| InChI | InChI=1S/C19H16N4/c1-20-8-12-2-3-17-14(6-12)15(10-21-17)13-7-16-18(22-9-13)23-11-19(16)4-5-19/h2-3,6-7,9-10,21H,4-5,8,11H2,(H,22,23) |
| InChIKey | KAIROOSTAFFVTB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|