C12H25NO3 — CID 166035268
(2R,4R)-2-ethyl-4-[2-(2-methoxyethoxy)ethoxy]-1-methylpyrrolidine (PubChem CID 166035268) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-4-[2-(2-methoxyethoxy)ethoxy]-1-methylpyrrolidine.
| Compound Name | (2R,4R)-2-ethyl-4-[2-(2-methoxyethoxy)ethoxy]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 166035268 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | (2R,4R)-2-ethyl-4-[2-(2-methoxyethoxy)ethoxy]-1-methylpyrrolidine |
| SMILES | CC[C@@H]1C[C@@H](OCCOCCOC)CN1C |
| InChI | InChI=1S/C12H25NO3/c1-4-11-9-12(10-13(11)2)16-8-7-15-6-5-14-3/h11-12H,4-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | CZLYXFLHMVKIFM-VXGBXAGGSA-N |
| XLogP | 1.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|