C10H13N5O3 — CID 166036165
5-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-1,3-diazinane-2,4-dione (PubChem CID 166036165) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 5-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 5-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 166036165 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 5-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1NCC(n2nc3n(c2=O)CCCC3)C(=O)N1 |
| InChI | InChI=1S/C10H13N5O3/c16-8-6(5-11-9(17)12-8)15-10(18)14-4-2-1-3-7(14)13-15/h6H,1-5H2,(H2,11,12,16,17) |
| InChIKey | WBBGPZVMKIHRPW-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |