About 1,5-ditert-butyl-2,4-difluorocyclohexane
1,5-ditert-butyl-2,4-difluorocyclohexane (PubChem CID 166036476) has the molecular formula C14H26F2
and a molecular weight of 232.36 g/mol. Its IUPAC name is 1,5-ditert-butyl-2,4-difluorocyclohexane.
Molecular Properties
| Compound Name | 1,5-ditert-butyl-2,4-difluorocyclohexane |
| PubChem CID | 166036476 |
| Molecular Formula | C14H26F2 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1,5-ditert-butyl-2,4-difluorocyclohexane |
| SMILES | CC(C)(C)C1CC(C(C)(C)C)C(F)CC1F |
| InChI | InChI=1S/C14H26F2/c1-13(2,3)9-7-10(14(4,5)6)12(16)8-11(9)15/h9-12H,7-8H2,1-6H3 |
| InChIKey | ZZCPCNVEOAQSLY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-ditert-butyl-2,4-difluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-ditert-butyl-2,4-difluorocyclohexane?
The IUPAC name of 1,5-ditert-butyl-2,4-difluorocyclohexane (CID 166036476) is 1,5-ditert-butyl-2,4-difluorocyclohexane.
What is the SMILES notation for 1,5-ditert-butyl-2,4-difluorocyclohexane?
The canonical SMILES for 1,5-ditert-butyl-2,4-difluorocyclohexane is CC(C)(C)C1CC(C(C)(C)C)C(F)CC1F.
What is the InChIKey of 1,5-ditert-butyl-2,4-difluorocyclohexane?
The InChIKey is ZZCPCNVEOAQSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F2/c1-13(2,3)9-7-10(14(4,5)6)12(16)8-11(9)15/h9-12H,7-8H2,1-6H3.
What are the key properties of 1,5-ditert-butyl-2,4-difluorocyclohexane?
1,5-ditert-butyl-2,4-difluorocyclohexane has a molecular weight of 232.36 g/mol, XLogP of 4.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-ditert-butyl-2,4-difluorocyclohexane is sourced from PubChem (CID 166036476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).