C59H64N2OSi — CID 166037047
5,5-bis(2-ethylhexyl)-3,7-bis(1-methyl-2-phenylindolizin-3-yl)benzo[b][1]benzosilin-10-one (PubChem CID 166037047) has the molecular formula C59H64N2OSi and a molecular weight of 845.26 g/mol. Its IUPAC name is 5,5-bis(2-ethylhexyl)-3,7-bis(1-methyl-2-phenylindolizin-3-yl)benzo[b][1]benzosilin-10-one.
| Compound Name | 5,5-bis(2-ethylhexyl)-3,7-bis(1-methyl-2-phenylindolizin-3-yl)benzo[b][1]benzosilin-10-one |
|---|---|
| PubChem CID | 166037047 |
| Molecular Formula | C59H64N2OSi |
| Molecular Weight | 845.26 g/mol |
| Exact Mass | 844.48 |
| IUPAC Name | 5,5-bis(2-ethylhexyl)-3,7-bis(1-methyl-2-phenylindolizin-3-yl)benzo[b][1]benzosilin-10-one |
| SMILES | CCCCC(CC)C[Si]1(CC(CC)CCCC)c2cc(-c3c(-c4ccccc4)c(C)c4ccccn34)ccc2C(=O)c2ccc(-c3c(-c4ccccc4)c(C)c4ccccn34)cc21 |
| InChI | InChI=1S/C59H64N2OSi/c1-7-11-23-43(9-3)39-63(40-44(10-4)24-12-8-2)53-37-47(57-55(45-25-15-13-16-26-45)41(5)51-29-19-21-35-60(51)57)31-33-49(53)59(62)50-34-32-48(38-54(50)63)58-56(46-27-17-14-18-28-46)42(6)52-30-20-22-36-61(52)58/h13-22,25-38,43-44H,7-12,23-24,39-40H2,1-6H3 |
| InChIKey | QNUHAKQYDQTORO-UHFFFAOYSA-N |
| XLogP | 15.02 |
| TPSA | 25.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.26 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|